Guanidine Phosphate#5423-23-4 Product Description
Guanidine phosphate is an inorganic salt derived from the reaction of guanidine with phosphoric acid. It has a molecular formula commonly represented as CH₆N₃·H₃PO₄ and a molecular weight of approximately 170.09 g/mol. Under normal conditions, it is generally supplied as a white crystalline powder or crystalline solid, with high-purity grades characterized by a uniform white appearance and the absence of visible impurities. Guanidine phosphate exhibits excellent water solubility, readily dissolving in water to form a clear, colorless solution. For example, a 4% aqueous solution can remain transparent without noticeable turbidity under suitable conditions. In contrast, its solubility in many organic solvents is relatively low, making its solubility profile an important consideration when selecting it for water-based formulations and industrial applications. These physical and chemical characteristics help define its handling, formulation, and suitability for different applications.
Guanidine Phosphate#5423-23-4 Chemical Properties
| Melting point | 247-250 °C (dec.) |
| density | 1.48 |
| vapor pressure | 0Pa at 25℃ |
| storage temp. | Room Temperature |
| solubility | H2O: 0.1 g/mL, clear, colorless |
| form | Solid |
| color | White to Off-White |
| Water Solubility | 250g/L at 20℃ |
| InChI | InChI=1S/CH5N3.H3O4P/c2-1(3)4;1-5(2,3)4/h(H5,2,3,4);(H3,1,2,3,4) |
| InChIKey | CEDDGDWODCGBFQ-UHFFFAOYSA-N |
| SMILES | C(N)(N)=N.P(O)(O)(O)=O |
| LogP | -3.48 at 25℃ |
| CAS DataBase Reference | 5423-23-4(CAS DataBase Reference) |
Guanidine phosphate#5423-23-4 Safety Information
| Hazard Codes | Xn |
| Risk Statements | 20/22-36/38 |
| Safety Statements | 26-37 |
| WGK Germany | 3 |
| HS Code | 2925.29.9000 |
Guanidine Phosphate#5423-23-4 Product Application
Guanidine phosphate serves as a valuable chemical intermediate in the production of various guanidine derivatives, pharmaceutical intermediates, and fine chemical compounds. It can be used in the synthesis of selected antibacterial drug intermediates, as well as certain dyes and other specialty chemicals, depending on the specific production process. In addition to its role in chemical synthesis, guanidine phosphate contains both nitrogen and phosphorus, two essential nutrients required for plant growth and development. With its reported nitrogen content of approximately 25% and phosphorus content of around 18%, it may also be considered for use in nitrogen-phosphorus fertilizer formulations or as a fertilizer additive. Its suitability for agricultural applications depends on the actual product composition, nutrient analysis, and the requirements of the intended formulation.
