Crospovidone CAS#25249-54-1
Cross-linked polyvinylpyrrolidone, commonly known as PVPP or Crospovidone, is a crosslinked polymer synthesized through the polymerization of vinylpyrrolidone monomers under controlled reaction conditions. It remains insoluble in water, concentrated acids, concentrated alkalis and typical organic solvents. As a premium fine polymer chemical, PVPP has a host of unique advantageous properties, allowing it to be extensively applied in cosmetics, food and pharmaceutical sectors.
Crospovidone Chemical Properties
| English Name | Crospovidone |
| English Synonyms | K-30;PVPD;POLYVINYLPYRROLIDONE K 15;POLYVINYLPYRROLIDONE K 25;POLYVINYLPYRROLIDONE K 60;P olyKoVidoneTM;Polyvinylpyrrolidone, cross-linked 1KG;Polyvinylpyrrolidone, cross-linked 25GR |
| CAS Number | 25249-54-1 |
| Molecular Formula | C6H9NO |
| Molecular Weight | 111.14176 |
| EINECS Number | 607-660-4 |
| Melting point | ~165 °C (dec.)(lit.) |
| form | powder |
| color | White to off-white |
| Water Solubility | Insoluble in water, acid and alkaline. |
| CAS DataBase Reference | 25249-54-1 |
| Safety Statements | 22-24/25 |
| WGK Germany | 1 |
| RTECS | TR8370000 |
| HS Code | 39059900 |
| InChI | InChI=1S/C6H9NO/c1-2-7-5-3-4-6(7)8/h2H,1,3-5H2 |
| InChIKey | WHNWPMSKXPGLAX-UHFFFAOYSA-N |
| SMILES | N1(C=C)CCCC1=0 |
Product Application of Crospovidone CAS#25249-54-1
Cross‑linked polyvinylpyrrolidone, or PVPP (also called Crospovidone), is a crosslinked polymer formed by the polymerization of vinylpyrrolidone monomers under defined reaction conditions. It does not dissolve in water, concentrated acids, concentrated alkalis or routine organic solvents. As a key fine polymer chemical, PVPP exhibits a range of unique, desirable properties, supporting its broad use across cosmetic, food and pharmaceutical industries.
