Product Overview
Maltodextrin is a starch-derived carbohydrate produced through the partial hydrolysis of starch using enzymatic or acid-based processes. It is assigned CAS number 9050-36-6 and is commonly manufactured from corn, tapioca, potato, or other starch sources. Unlike a single pure molecular compound, maltodextrin consists of a mixture of glucose polymers and shorter carbohydrate chains. Therefore, its molecular weight and exact composition vary depending on the manufacturing process and dextrose equivalent (DE) value.
Commercial Maltodextrin is generally supplied as a white to off-white, free-flowing powder with a mild or nearly neutral taste and odor. It is readily soluble or dispersible in water, making it suitable for numerous formulation processes. Its functional properties include providing bulk, improving texture, supporting product consistency, and acting as a carrier for flavors, colors, and other ingredients.
Maltodextrin is widely used in food and beverage manufacturing, pharmaceutical formulations, cosmetics, and nutritional products. Different DE grades offer varying levels of sweetness, viscosity, and functional performance. The selection of an appropriate grade depends on the intended application, raw material source, and product specifications.
| Maltodextrin Chemical Properties |
| Melting point | 240 °C (dec.) (lit.) |
| density | 1.81 g/cm3 |
| refractive index | 1.673 |
| storage temp. | room temp |
| solubility | H2O: 0.1 g/mL hot, complete, yellow to very deep yellow |
| form | powder |
| color | yellow |
| Odor | at 100.00%. odorless |
| biological source | maize |
| Cosmetics Ingredients Functions | ABSORBENT FILM FORMING BINDING SKIN CONDITIONING EMULSION STABILISING HAIR CONDITIONING |
| Cosmetic Ingredient Review (CIR) | Maltodextrin (9050-36-6) |
| InChI | InChI=1/C12H22O11/c13-1-3-5(15)6(16)9(19)12(22-3)23-10-4(2-14)21-11(20)8(18)7(10)17/h3-20H,1-2H2/t3,4,5-,6,7,8,9,10-,11+,12-/s3 |
| InChIKey | GUBGYTABKSRVRQ-CKGNGCRFNA-N |
| SMILES | C1(CO)O[C@H](O[C@H]2C(O)C(O)[C@@H](O)OC2CO)C(O)C(O)[C@@H]1O |&1:4,6,11,21,r| |
| LogP | -4.673 (est) |
| CAS DataBase Reference | 9050-36-6 |
| EPA Substance Registry System | Maltodextrin (9050-36-6) |
| Safety Information |
| Safety Statements | 24/25 |
| WGK Germany | 3 |
| RTECS | HH9450000 |
| F | 3 |
| TSCA | TSCA listed |
| HS Code | 35051000 |
| Storage Class | 11 - Combustible Solids |
Main Applications
Food and beverage formulations.
Powdered drinks and nutritional products.
Flavor and color carrier applications.
Pharmaceutical excipients and tablet formulations.
Spray drying and encapsulation processes.
Bakery, confectionery, and dairy products.
Cosmetic and personal care formulations.
Industrial carbohydrate-based formulations.
