4-Aminoisoquinoline CAS#23687-25-4 Product Description
4-Aminoisoquinoline is a nitrogen-containing heterocyclic organic compound that is commonly used as a biochemical reagent and research material in life science and chemical research applications. It typically appears as a white to brown crystalline powder and exhibits good solubility in methanol. The compound has the molecular formula C₉H₈N₂ and a molecular weight of 144.17 g/mol. Its melting point ranges from 108.0 to 112.0 °C, while its predicted boiling point is approximately 360.0 ± 17.0 °C. Featuring an amino functional group attached to an isoquinoline ring system, 4-Aminoisoquinoline serves as a useful heterocyclic building block for various chemical transformations. Its distinctive molecular structure and functional properties make it suitable for applications in biochemical research, organic synthesis, pharmaceutical development, and the preparation of specialized organic compounds.
4-Aminoisoquinoline CAS#23687-25-4 Chemical Properties
| Melting point | 108.0 to 112.0 °C |
| Boiling point | 360.0±17.0 °C(Predicted) |
| Density | 1.210±0.06 g/cm3(Predicted) |
| Storage temp | Keep in dark place,Inert atmosphere,Room temperature |
| Solubility | soluble in Methanol |
| Form | powder to crystal |
| Pka | 6.29±0.10(Predicted) |
| Color | White to Brown |
| InChI | InChI=1S/C9H8N2/c10-9-6-11-5-7-3-1-2-4-8(7)9/h1-6H,10H2 |
| InChIKey | ISIUXVGHQFJYHM-UHFFFAOYSA-N |
| SMILES | C1C2=C(C=CC=C2)C(N)=CN=1 |
| CAS DataBase Reference | 23687-25-4(CAS DataBase Reference) |
4-Aminoisoquinoline CAS#23687-25-4 Safety Information
| Hazard Codes | Xi,Xn |
| Risk Statements | 22-36 |
| Safety Statements | 26 |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| HS Code | 2933499090 |
4-Aminoisoquinoline CAS#23687-25-4 Product Application
1. Pharmaceutical Intermediates
Can be used as a synthetic intermediate for isoquinoline-based pharmaceutical candidate molecules.
Suitable for the construction of nitrogen-containing heterocyclic compounds with potential biological activities.
Can be used in the design and synthesis of novel pharmaceutical candidate molecules.
Serves as a basic building block for pharmaceutical molecular structure optimization and derivative development.
2. Medicinal Chemistry Research
Can be used in the design and synthesis of pharmaceutical molecules containing an isoquinoline structure.
Its amino group can participate in amidation, alkylation and other derivatization reactions.
Suitable for the research and development of novel nitrogen-containing heterocyclic small-molecule compounds.
Serves as a synthetic building block for drug lead design and structure-activity relationship (SAR) studies.
3. Fine Chemical Synthesis
Can be used in the synthesis of various aminoisoquinoline derivatives.
Serves as an important organic synthesis building block for nitrogen-containing fused heterocyclic compounds.
Its amino functional group allows further chemical modification and molecular structure optimization.
Suitable for the development of customized chemicals and specialty organic intermediates.
4. Bioactive Compound Research
Can be used in the design and synthesis of isoquinoline derivatives with potential biological activities.
Suitable for the research and development of novel bioactive nitrogen-containing heterocyclic molecules.
Serves as a starting material for research into small-molecule compounds with potential antimicrobial and other biological activities.
Applicable to drug discovery, molecular design and laboratory pharmacological research.
